C40H39N3O7S — CID 118365805
methyl 5-[[2-[benzyl-(4-phenylphenyl)sulfonylamino]acetyl]-[(4-morpholin-4-ylphenyl)methyl]amino]-2-hydroxybenzoate (PubChem CID 118365805) has the molecular formula C40H39N3O7S and a molecular weight of 705.83 g/mol. Its IUPAC name is methyl 5-[[2-[benzyl-(4-phenylphenyl)sulfonylamino]acetyl]-[(4-morpholin-4-ylphenyl)methyl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 5-[[2-[benzyl-(4-phenylphenyl)sulfonylamino]acetyl]-[(4-morpholin-4-ylphenyl)methyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 118365805 |
| Molecular Formula | C40H39N3O7S |
| Molecular Weight | 705.83 g/mol |
| Exact Mass | 705.25 |
| IUPAC Name | methyl 5-[[2-[benzyl-(4-phenylphenyl)sulfonylamino]acetyl]-[(4-morpholin-4-ylphenyl)methyl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(N(Cc2ccc(N3CCOCC3)cc2)C(=O)CN(Cc2ccccc2)S(=O)(=O)c2ccc(-c3ccccc3)cc2)ccc1O |
| InChI | InChI=1S/C40H39N3O7S/c1-49-40(46)37-26-35(18-21-38(37)44)43(28-31-12-16-34(17-13-31)41-22-24-50-25-23-41)39(45)29-42(27-30-8-4-2-5-9-30)51(47,48)36-19-14-33(15-20-36)32-10-6-3-7-11-32/h2-21,26,44H,22-25,27-29H2,1H3 |
| InChIKey | XGNGQQVUNVODGG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.83 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|