C39H37N3O7S — CID 118365806
5-[[2-[(3-benzyl-4-phenylphenyl)sulfonylamino]acetyl]-[(4-morpholin-4-ylphenyl)methyl]amino]-2-hydroxybenzoic acid (PubChem CID 118365806) has the molecular formula C39H37N3O7S and a molecular weight of 691.81 g/mol. Its IUPAC name is 5-[[2-[(3-benzyl-4-phenylphenyl)sulfonylamino]acetyl]-[(4-morpholin-4-ylphenyl)methyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[(3-benzyl-4-phenylphenyl)sulfonylamino]acetyl]-[(4-morpholin-4-ylphenyl)methyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 118365806 |
| Molecular Formula | C39H37N3O7S |
| Molecular Weight | 691.81 g/mol |
| Exact Mass | 691.24 |
| IUPAC Name | 5-[[2-[(3-benzyl-4-phenylphenyl)sulfonylamino]acetyl]-[(4-morpholin-4-ylphenyl)methyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(N(Cc2ccc(N3CCOCC3)cc2)C(=O)CNS(=O)(=O)c2ccc(-c3ccccc3)c(Cc3ccccc3)c2)ccc1O |
| InChI | InChI=1S/C39H37N3O7S/c43-37-18-15-33(25-36(37)39(45)46)42(27-29-11-13-32(14-12-29)41-19-21-49-22-20-41)38(44)26-40-50(47,48)34-16-17-35(30-9-5-2-6-10-30)31(24-34)23-28-7-3-1-4-8-28/h1-18,24-25,40,43H,19-23,26-27H2,(H,45,46) |
| InChIKey | QVXKOWUJEBYJMP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.81 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|