C22H23NO — CID 118370203
1-benzhydryl-3-cyclohexa-1,5-dien-1-yloxyazetidine (PubChem CID 118370203) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-benzhydryl-3-cyclohexa-1,5-dien-1-yloxyazetidine.
| Compound Name | 1-benzhydryl-3-cyclohexa-1,5-dien-1-yloxyazetidine |
|---|---|
| PubChem CID | 118370203 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 1-benzhydryl-3-cyclohexa-1,5-dien-1-yloxyazetidine |
| SMILES | C1=CC(OC2CN(C(c3ccccc3)c3ccccc3)C2)=CCC1 |
| InChI | InChI=1S/C22H23NO/c1-4-10-18(11-5-1)22(19-12-6-2-7-13-19)23-16-21(17-23)24-20-14-8-3-9-15-20/h1-2,4-8,10-15,21-22H,3,9,16-17H2 |
| InChIKey | QYCJUZQOUIQHIJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |