C27H25ClF6N4O4 — CID 118380421
[4-[4-[2-chloro-5-[[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]methyl]phenyl]-6-methoxy-1,3,5-triazin-2-yl]phenyl] 3,3,3-trifluoro-2,2-dimethylpropanoate (PubChem CID 118380421) has the molecular formula C27H25ClF6N4O4 and a molecular weight of 618.96 g/mol. Its IUPAC name is [4-[4-[2-chloro-5-[[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]methyl]phenyl]-6-methoxy-1,3,5-triazin-2-yl]phenyl] 3,3,3-trifluoro-2,2-dimethylpropanoate.
| Compound Name | [4-[4-[2-chloro-5-[[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]methyl]phenyl]-6-methoxy-1,3,5-triazin-2-yl]phenyl] 3,3,3-trifluoro-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118380421 |
| Molecular Formula | C27H25ClF6N4O4 |
| Molecular Weight | 618.96 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | [4-[4-[2-chloro-5-[[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]methyl]phenyl]-6-methoxy-1,3,5-triazin-2-yl]phenyl] 3,3,3-trifluoro-2,2-dimethylpropanoate |
| SMILES | COc1nc(-c2ccc(OC(=O)C(C)(C)C(F)(F)F)cc2)nc(-c2cc(CNC(=O)C(C)(C)C(F)(F)F)ccc2Cl)n1 |
| InChI | InChI=1S/C27H25ClF6N4O4/c1-24(2,26(29,30)31)21(39)35-13-14-6-11-18(28)17(12-14)20-36-19(37-23(38-20)41-5)15-7-9-16(10-8-15)42-22(40)25(3,4)27(32,33)34/h6-12H,13H2,1-5H3,(H,35,39) |
| InChIKey | DEBQEEYUPGZUJG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.96 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|