C29H27IN2O3 — CID 118413382
3-[3-[1-(iodomethyl)indol-4-yl]oxypropyl]-1-methyl-7-(2-methylphenyl)indole-2-carboxylic acid (PubChem CID 118413382) has the molecular formula C29H27IN2O3 and a molecular weight of 578.45 g/mol. Its IUPAC name is 3-[3-[1-(iodomethyl)indol-4-yl]oxypropyl]-1-methyl-7-(2-methylphenyl)indole-2-carboxylic acid.
| Compound Name | 3-[3-[1-(iodomethyl)indol-4-yl]oxypropyl]-1-methyl-7-(2-methylphenyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 118413382 |
| Molecular Formula | C29H27IN2O3 |
| Molecular Weight | 578.45 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | 3-[3-[1-(iodomethyl)indol-4-yl]oxypropyl]-1-methyl-7-(2-methylphenyl)indole-2-carboxylic acid |
| SMILES | Cc1ccccc1-c1cccc2c(CCCOc3cccc4c3ccn4CI)c(C(=O)O)n(C)c12 |
| InChI | InChI=1S/C29H27IN2O3/c1-19-8-3-4-9-20(19)21-10-5-11-22-23(28(29(33)34)31(2)27(21)22)12-7-17-35-26-14-6-13-25-24(26)15-16-32(25)18-30/h3-6,8-11,13-16H,7,12,17-18H2,1-2H3,(H,33,34) |
| InChIKey | MMIPBQSUTKQFIJ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 56.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.45 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|