C23H21NO8 — CID 11841585
tetramethyl 6-phenyl-9aH-quinolizine-1,2,3,4-tetracarboxylate (PubChem CID 11841585) has the molecular formula C23H21NO8 and a molecular weight of 439.42 g/mol. Its IUPAC name is tetramethyl 6-phenyl-9aH-quinolizine-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl 6-phenyl-9aH-quinolizine-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 11841585 |
| Molecular Formula | C23H21NO8 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | tetramethyl 6-phenyl-9aH-quinolizine-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C=CC=C(c3ccccc3)N2C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C23H21NO8/c1-29-20(25)16-15-12-8-11-14(13-9-6-5-7-10-13)24(15)19(23(28)32-4)18(22(27)31-3)17(16)21(26)30-2/h5-12,15H,1-4H3 |
| InChIKey | YMDHZJVASUXZFI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|