C19H23N6O9P — CID 118426424
(2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]phosphorylamino]propanoate (PubChem CID 118426424) has the molecular formula C19H23N6O9P and a molecular weight of 510.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]phosphorylamino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]phosphorylamino]propanoate |
|---|---|
| PubChem CID | 118426424 |
| Molecular Formula | C19H23N6O9P |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]phosphorylamino]propanoate |
| SMILES | O=C(CCNP(=O)(NCCN1C(=O)C=CC1=O)NCCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H23N6O9P/c26-13-1-2-14(27)23(13)11-9-21-35(33,22-10-12-24-15(28)3-4-16(24)29)20-8-7-19(32)34-25-17(30)5-6-18(25)31/h1-4H,5-12H2,(H3,20,21,22,33) |
| InChIKey | VTAFBWCPHVXCOR-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 191.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|