C20H23N4O9P — CID 118426385
(2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethyl]phosphoryl-methylamino]propanoate (PubChem CID 118426385) has the molecular formula C20H23N4O9P and a molecular weight of 494.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethyl]phosphoryl-methylamino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethyl]phosphoryl-methylamino]propanoate |
|---|---|
| PubChem CID | 118426385 |
| Molecular Formula | C20H23N4O9P |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethyl]phosphoryl-methylamino]propanoate |
| SMILES | CN(CCC(=O)ON1C(=O)CCC1=O)P(=O)(CCN1C(=O)C=CC1=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H23N4O9P/c1-21(9-8-20(31)33-24-18(29)6-7-19(24)30)34(32,12-10-22-14(25)2-3-15(22)26)13-11-23-16(27)4-5-17(23)28/h2-5H,6-13H2,1H3 |
| InChIKey | GPMYGEUHOUQPPC-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 158.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|