C15H21N4O8P — CID 118423985
[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-methylamino]-[2-(2,5-dioxopyrrol-1-yl)ethyl-methylamino]phosphinic acid (PubChem CID 118423985) has the molecular formula C15H21N4O8P and a molecular weight of 416.33 g/mol. Its IUPAC name is [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-methylamino]-[2-(2,5-dioxopyrrol-1-yl)ethyl-methylamino]phosphinic acid.
| Compound Name | [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-methylamino]-[2-(2,5-dioxopyrrol-1-yl)ethyl-methylamino]phosphinic acid |
|---|---|
| PubChem CID | 118423985 |
| Molecular Formula | C15H21N4O8P |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-methylamino]-[2-(2,5-dioxopyrrol-1-yl)ethyl-methylamino]phosphinic acid |
| SMILES | CN(CCC(=O)ON1C(=O)CCC1=O)P(=O)(O)N(C)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H21N4O8P/c1-16(8-7-15(24)27-19-13(22)5-6-14(19)23)28(25,26)17(2)9-10-18-11(20)3-4-12(18)21/h3-4H,5-10H2,1-2H3,(H,25,26) |
| InChIKey | XYAUPJUEMGEIGI-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|