C19H26O2S — CID 118461539
1,3-ditert-butylspiro[cyclopenta[c]thiophene-5,1'-cyclopentane]-4,6-dione (PubChem CID 118461539) has the molecular formula C19H26O2S and a molecular weight of 318.48 g/mol. Its IUPAC name is 1,3-ditert-butylspiro[cyclopenta[c]thiophene-5,1'-cyclopentane]-4,6-dione.
| Compound Name | 1,3-ditert-butylspiro[cyclopenta[c]thiophene-5,1'-cyclopentane]-4,6-dione |
|---|---|
| PubChem CID | 118461539 |
| Molecular Formula | C19H26O2S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1,3-ditert-butylspiro[cyclopenta[c]thiophene-5,1'-cyclopentane]-4,6-dione |
| SMILES | CC(C)(C)c1sc(C(C)(C)C)c2c1C(=O)C1(CCCC1)C2=O |
| InChI | InChI=1S/C19H26O2S/c1-17(2,3)15-11-12(16(22-15)18(4,5)6)14(21)19(13(11)20)9-7-8-10-19/h7-10H2,1-6H3 |
| InChIKey | VMHJUSBYBYJXAJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|