C12H12F2O2S — CID 145470162
3-tert-butyl-5,5-difluoro-1-methylcyclopenta[c]thiophene-4,6-dione (PubChem CID 145470162) has the molecular formula C12H12F2O2S and a molecular weight of 258.29 g/mol. Its IUPAC name is 3-tert-butyl-5,5-difluoro-1-methylcyclopenta[c]thiophene-4,6-dione.
| Compound Name | 3-tert-butyl-5,5-difluoro-1-methylcyclopenta[c]thiophene-4,6-dione |
|---|---|
| PubChem CID | 145470162 |
| Molecular Formula | C12H12F2O2S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 3-tert-butyl-5,5-difluoro-1-methylcyclopenta[c]thiophene-4,6-dione |
| SMILES | Cc1sc(C(C)(C)C)c2c1C(=O)C(F)(F)C2=O |
| InChI | InChI=1S/C12H12F2O2S/c1-5-6-7(10(17-5)11(2,3)4)9(16)12(13,14)8(6)15/h1-4H3 |
| InChIKey | VDVVVPIVNVBEQY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|