C19H26Cl2N2O2 — CID 11847707
3-chloro-5-(6-heptyl-4-oxo-1H-pyridin-3-yl)-2,6-dimethyl-1H-pyridin-4-one;hydrochloride (PubChem CID 11847707) has the molecular formula C19H26Cl2N2O2 and a molecular weight of 385.34 g/mol. Its IUPAC name is 3-chloro-5-(6-heptyl-4-oxo-1H-pyridin-3-yl)-2,6-dimethyl-1H-pyridin-4-one;hydrochloride.
| Compound Name | 3-chloro-5-(6-heptyl-4-oxo-1H-pyridin-3-yl)-2,6-dimethyl-1H-pyridin-4-one;hydrochloride |
|---|---|
| PubChem CID | 11847707 |
| Molecular Formula | C19H26Cl2N2O2 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3-chloro-5-(6-heptyl-4-oxo-1H-pyridin-3-yl)-2,6-dimethyl-1H-pyridin-4-one;hydrochloride |
| SMILES | CCCCCCCc1cc(=O)c(-c2c(C)[nH]c(C)c(Cl)c2=O)c[nH]1.Cl |
| InChI | InChI=1S/C19H25ClN2O2.ClH/c1-4-5-6-7-8-9-14-10-16(23)15(11-21-14)17-12(2)22-13(3)18(20)19(17)24;/h10-11H,4-9H2,1-3H3,(H,21,23)(H,22,24);1H |
| InChIKey | CPXCDQNAWFGOIO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|