C15H17FN2 — CID 118481818
(11aR)-7-fluoro-9-methyl-2,3,5,10,11,11a-hexahydro-1H-indolizino[7,6-b]indole (PubChem CID 118481818) has the molecular formula C15H17FN2 and a molecular weight of 244.31 g/mol. Its IUPAC name is (11aR)-7-fluoro-9-methyl-2,3,5,10,11,11a-hexahydro-1H-indolizino[7,6-b]indole.
| Compound Name | (11aR)-7-fluoro-9-methyl-2,3,5,10,11,11a-hexahydro-1H-indolizino[7,6-b]indole |
|---|---|
| PubChem CID | 118481818 |
| Molecular Formula | C15H17FN2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (11aR)-7-fluoro-9-methyl-2,3,5,10,11,11a-hexahydro-1H-indolizino[7,6-b]indole |
| SMILES | Cc1cc(F)cc2c3c([nH]c12)C[C@H]1CCCN1C3 |
| InChI | InChI=1S/C15H17FN2/c1-9-5-10(16)6-12-13-8-18-4-2-3-11(18)7-14(13)17-15(9)12/h5-6,11,17H,2-4,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | ABCFZRVDRUPXQM-LLVKDONJSA-N |
| XLogP | 3.14 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|