C6H13N3O5S2 — CID 118492963
2-[methyl-[(E)-N'-(2-sulfoethylsulfanyl)carbamimidoyl]amino]acetic acid (PubChem CID 118492963) has the molecular formula C6H13N3O5S2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-[methyl-[(E)-N'-(2-sulfoethylsulfanyl)carbamimidoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[(E)-N'-(2-sulfoethylsulfanyl)carbamimidoyl]amino]acetic acid |
|---|---|
| PubChem CID | 118492963 |
| Molecular Formula | C6H13N3O5S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-[methyl-[(E)-N'-(2-sulfoethylsulfanyl)carbamimidoyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)/C(N)=N/SCCS(=O)(=O)O |
| InChI | InChI=1S/C6H13N3O5S2/c1-9(4-5(10)11)6(7)8-15-2-3-16(12,13)14/h2-4H2,1H3,(H2,7,8)(H,10,11)(H,12,13,14) |
| InChIKey | XXWQVOKQOWMNHJ-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|