C20H16N2O8 — CID 118494606
(E)-3-[3-[(E)-1-(4-hydroxy-3-methoxyphenyl)-3-nitroso-3-oxoprop-1-en-2-yl]-5-methoxy-4-nitrosophenyl]prop-2-enoic acid (PubChem CID 118494606) has the molecular formula C20H16N2O8 and a molecular weight of 412.35 g/mol. Its IUPAC name is (E)-3-[3-[(E)-1-(4-hydroxy-3-methoxyphenyl)-3-nitroso-3-oxoprop-1-en-2-yl]-5-methoxy-4-nitrosophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(E)-1-(4-hydroxy-3-methoxyphenyl)-3-nitroso-3-oxoprop-1-en-2-yl]-5-methoxy-4-nitrosophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118494606 |
| Molecular Formula | C20H16N2O8 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (E)-3-[3-[(E)-1-(4-hydroxy-3-methoxyphenyl)-3-nitroso-3-oxoprop-1-en-2-yl]-5-methoxy-4-nitrosophenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C(/C(=O)N=O)c2cc(/C=C/C(=O)O)cc(OC)c2N=O)ccc1O |
| InChI | InChI=1S/C20H16N2O8/c1-29-16-9-11(3-5-15(16)23)8-14(20(26)22-28)13-7-12(4-6-18(24)25)10-17(30-2)19(13)21-27/h3-10,23H,1-2H3,(H,24,25)/b6-4+,14-8+ |
| InChIKey | QPYJWSJYLVYWGZ-SITOFEAGSA-N |
| XLogP | 3.74 |
| TPSA | 151.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|