About CID 118512109
CID 118512109 (PubChem CID 118512109) has the molecular formula C10H7PS2
and a molecular weight of 222.27 g/mol.
Molecular Properties
| Compound Name | CID 118512109 |
| PubChem CID | 118512109 |
| Molecular Formula | C10H7PS2 |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | — |
| SMILES | S=P(=S)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H7PS2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | CVOHMJIMTVLWRH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 118512109 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118512109?
The IUPAC name of CID 118512109 (CID 118512109) is not available.
What is the SMILES notation for CID 118512109?
The canonical SMILES for CID 118512109 is S=P(=S)c1ccc2ccccc2c1.
What is the InChIKey of CID 118512109?
The InChIKey is CVOHMJIMTVLWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7PS2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H.
What are the key properties of CID 118512109?
CID 118512109 has a molecular weight of 222.27 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118512109 is sourced from PubChem (CID 118512109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).