C32H51O3P — CID 118513743
2,2-bis[2-methyl-4,6-bis(2-methylpropyl)phenyl]ethyl dihydrogen phosphite (PubChem CID 118513743) has the molecular formula C32H51O3P and a molecular weight of 514.73 g/mol. Its IUPAC name is 2,2-bis[2-methyl-4,6-bis(2-methylpropyl)phenyl]ethyl dihydrogen phosphite.
| Compound Name | 2,2-bis[2-methyl-4,6-bis(2-methylpropyl)phenyl]ethyl dihydrogen phosphite |
|---|---|
| PubChem CID | 118513743 |
| Molecular Formula | C32H51O3P |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | 2,2-bis[2-methyl-4,6-bis(2-methylpropyl)phenyl]ethyl dihydrogen phosphite |
| SMILES | Cc1cc(CC(C)C)cc(CC(C)C)c1C(COP(O)O)c1c(C)cc(CC(C)C)cc1CC(C)C |
| InChI | InChI=1S/C32H51O3P/c1-20(2)11-26-15-24(9)31(28(17-26)13-22(5)6)30(19-35-36(33)34)32-25(10)16-27(12-21(3)4)18-29(32)14-23(7)8/h15-18,20-23,30,33-34H,11-14,19H2,1-10H3 |
| InChIKey | MEIHLHKWIVNCHQ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|