C31H29F8N3O3 — CID 118516126
N-(4-cyanophenyl)-5,5-difluoro-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)cyclohexyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 118516126) has the molecular formula C31H29F8N3O3 and a molecular weight of 643.58 g/mol. Its IUPAC name is N-(4-cyanophenyl)-5,5-difluoro-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)cyclohexyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-(4-cyanophenyl)-5,5-difluoro-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)cyclohexyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118516126 |
| Molecular Formula | C31H29F8N3O3 |
| Molecular Weight | 643.58 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | N-(4-cyanophenyl)-5,5-difluoro-4-(4-methylphenyl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)cyclohexyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | Cc1ccc(C2=C(C(=O)Nc3ccc(C#N)cc3)C(=O)NC(C3CCC(OCCCC(F)(F)F)CC3)(C(F)(F)F)C2(F)F)cc1 |
| InChI | InChI=1S/C31H29F8N3O3/c1-18-3-7-20(8-4-18)25-24(26(43)41-22-11-5-19(17-40)6-12-22)27(44)42-29(30(25,35)36,31(37,38)39)21-9-13-23(14-10-21)45-16-2-15-28(32,33)34/h3-8,11-12,21,23H,2,9-10,13-16H2,1H3,(H,41,43)(H,42,44) |
| InChIKey | QYLWOLWBVHSEEF-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.58 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|