C7H6N2O2 — CID 118518302
1-hydroxy-5H-pyrrolo[3,2-c]pyridin-6-one (PubChem CID 118518302) has the molecular formula C7H6N2O2 and a molecular weight of 150.14 g/mol. Its IUPAC name is 1-hydroxy-5H-pyrrolo[3,2-c]pyridin-6-one.
| Compound Name | 1-hydroxy-5H-pyrrolo[3,2-c]pyridin-6-one |
|---|---|
| PubChem CID | 118518302 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 1-hydroxy-5H-pyrrolo[3,2-c]pyridin-6-one |
| SMILES | O=c1cc2c(ccn2O)c[nH]1 |
| InChI | InChI=1S/C7H6N2O2/c10-7-3-6-5(4-8-7)1-2-9(6)11/h1-4,11H,(H,8,10) |
| InChIKey | GEOXGBDEJNQHKK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|