About 7-hydroxyfuro[3,2-f]indol-2-ol
7-hydroxyfuro[3,2-f]indol-2-ol (PubChem CID 118518253) has the molecular formula C10H7NO3
and a molecular weight of 189.17 g/mol. Its IUPAC name is 7-hydroxyfuro[3,2-f]indol-2-ol.
Molecular Properties
| Compound Name | 7-hydroxyfuro[3,2-f]indol-2-ol |
| PubChem CID | 118518253 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 7-hydroxyfuro[3,2-f]indol-2-ol |
| SMILES | Oc1cc2cc3ccn(O)c3cc2o1 |
| InChI | InChI=1S/C10H7NO3/c12-10-4-7-3-6-1-2-11(13)8(6)5-9(7)14-10/h1-5,12-13H |
| InChIKey | NYZXFXGCPRPQLK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxyfuro[3,2-f]indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxyfuro[3,2-f]indol-2-ol?
The IUPAC name of 7-hydroxyfuro[3,2-f]indol-2-ol (CID 118518253) is 7-hydroxyfuro[3,2-f]indol-2-ol.
What is the SMILES notation for 7-hydroxyfuro[3,2-f]indol-2-ol?
The canonical SMILES for 7-hydroxyfuro[3,2-f]indol-2-ol is Oc1cc2cc3ccn(O)c3cc2o1.
What is the InChIKey of 7-hydroxyfuro[3,2-f]indol-2-ol?
The InChIKey is NYZXFXGCPRPQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3/c12-10-4-7-3-6-1-2-11(13)8(6)5-9(7)14-10/h1-5,12-13H.
What are the key properties of 7-hydroxyfuro[3,2-f]indol-2-ol?
7-hydroxyfuro[3,2-f]indol-2-ol has a molecular weight of 189.17 g/mol, XLogP of 2.33, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxyfuro[3,2-f]indol-2-ol is sourced from PubChem (CID 118518253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).