C26H36N6O3S — CID 118542772
3-[5-[amino(methylsulfonyl)methyl]-3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 118542772) has the molecular formula C26H36N6O3S and a molecular weight of 512.68 g/mol. Its IUPAC name is 3-[5-[amino(methylsulfonyl)methyl]-3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[5-[amino(methylsulfonyl)methyl]-3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118542772 |
| Molecular Formula | C26H36N6O3S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 3-[5-[amino(methylsulfonyl)methyl]-3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(C(N)S(C)(=O)=O)CN(CC3CCN(Cc4ccccc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C26H36N6O3S/c1-36(34,35)25(29)22-17-31(26(33)32(18-22)23-9-5-8-21(14-23)24(27)28)16-20-10-12-30(13-11-20)15-19-6-3-2-4-7-19/h2-9,14,20,22,25H,10-13,15-18,29H2,1H3,(H3,27,28) |
| InChIKey | FZHRQZUSEHEBEK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|