C19H29N5O4S — CID 118542942
3-[5-(hydroxymethyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 118542942) has the molecular formula C19H29N5O4S and a molecular weight of 423.54 g/mol. Its IUPAC name is 3-[5-(hydroxymethyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[5-(hydroxymethyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118542942 |
| Molecular Formula | C19H29N5O4S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 3-[5-(hydroxymethyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(CO)CN(CC3CCN(S(C)(=O)=O)CC3)C2=O)c1 |
| InChI | InChI=1S/C19H29N5O4S/c1-29(27,28)23-7-5-14(6-8-23)10-22-11-15(13-25)12-24(19(22)26)17-4-2-3-16(9-17)18(20)21/h2-4,9,14-15,25H,5-8,10-13H2,1H3,(H3,20,21) |
| InChIKey | GSNVFLYCYDLFON-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|