C26H35N5O5S — CID 118542927
3-[5-(methoxymethyl)-3-[[1-(3-methoxyphenyl)sulfonylpiperidin-4-yl]methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 118542927) has the molecular formula C26H35N5O5S and a molecular weight of 529.66 g/mol. Its IUPAC name is 3-[5-(methoxymethyl)-3-[[1-(3-methoxyphenyl)sulfonylpiperidin-4-yl]methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[5-(methoxymethyl)-3-[[1-(3-methoxyphenyl)sulfonylpiperidin-4-yl]methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118542927 |
| Molecular Formula | C26H35N5O5S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 3-[5-(methoxymethyl)-3-[[1-(3-methoxyphenyl)sulfonylpiperidin-4-yl]methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(COC)CN(CC3CCN(S(=O)(=O)c4cccc(OC)c4)CC3)C2=O)c1 |
| InChI | InChI=1S/C26H35N5O5S/c1-35-18-20-16-29(26(32)31(17-20)22-6-3-5-21(13-22)25(27)28)15-19-9-11-30(12-10-19)37(33,34)24-8-4-7-23(14-24)36-2/h3-8,13-14,19-20H,9-12,15-18H2,1-2H3,(H3,27,28) |
| InChIKey | SNVUUJAPQRMXQD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|