C20H31N5O4S — CID 118542839
3-[5-(methoxymethyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 118542839) has the molecular formula C20H31N5O4S and a molecular weight of 437.57 g/mol. Its IUPAC name is 3-[5-(methoxymethyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[5-(methoxymethyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118542839 |
| Molecular Formula | C20H31N5O4S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 3-[5-(methoxymethyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(COC)CN(CC3CCN(S(C)(=O)=O)CC3)C2=O)c1 |
| InChI | InChI=1S/C20H31N5O4S/c1-29-14-16-12-23(11-15-6-8-24(9-7-15)30(2,27)28)20(26)25(13-16)18-5-3-4-17(10-18)19(21)22/h3-5,10,15-16H,6-9,11-14H2,1-2H3,(H3,21,22) |
| InChIKey | UVODFUNYBNYLIE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|