C30H36N6O4S — CID 118542946
3-[2-oxo-5-(phenylmethoxymethyl)-3-[(1-pyridin-4-ylsulfonylpiperidin-4-yl)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 118542946) has the molecular formula C30H36N6O4S and a molecular weight of 576.72 g/mol. Its IUPAC name is 3-[2-oxo-5-(phenylmethoxymethyl)-3-[(1-pyridin-4-ylsulfonylpiperidin-4-yl)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[2-oxo-5-(phenylmethoxymethyl)-3-[(1-pyridin-4-ylsulfonylpiperidin-4-yl)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118542946 |
| Molecular Formula | C30H36N6O4S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 3-[2-oxo-5-(phenylmethoxymethyl)-3-[(1-pyridin-4-ylsulfonylpiperidin-4-yl)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(COCc3ccccc3)CN(CC3CCN(S(=O)(=O)c4ccncc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C30H36N6O4S/c31-29(32)26-7-4-8-27(17-26)36-20-25(22-40-21-24-5-2-1-3-6-24)19-34(30(36)37)18-23-11-15-35(16-12-23)41(38,39)28-9-13-33-14-10-28/h1-10,13-14,17,23,25H,11-12,15-16,18-22H2,(H3,31,32) |
| InChIKey | WABVLMYCNGNSSU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|