C22H29N7O4S — CID 118543023
3-[5-(hydroxymethyl)-2-oxo-3-[(1-pyrimidin-5-ylsulfonylpiperidin-4-yl)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 118543023) has the molecular formula C22H29N7O4S and a molecular weight of 487.59 g/mol. Its IUPAC name is 3-[5-(hydroxymethyl)-2-oxo-3-[(1-pyrimidin-5-ylsulfonylpiperidin-4-yl)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[5-(hydroxymethyl)-2-oxo-3-[(1-pyrimidin-5-ylsulfonylpiperidin-4-yl)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118543023 |
| Molecular Formula | C22H29N7O4S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 3-[5-(hydroxymethyl)-2-oxo-3-[(1-pyrimidin-5-ylsulfonylpiperidin-4-yl)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(CO)CN(CC3CCN(S(=O)(=O)c4cncnc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C22H29N7O4S/c23-21(24)18-2-1-3-19(8-18)29-13-17(14-30)12-27(22(29)31)11-16-4-6-28(7-5-16)34(32,33)20-9-25-15-26-10-20/h1-3,8-10,15-17,30H,4-7,11-14H2,(H3,23,24) |
| InChIKey | JOBROOVEJIKZJU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 156.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|