C21H28N6O4S — CID 118542945
3-[5-methyl-3-[[1-(1,2-oxazol-4-ylsulfonyl)piperidin-4-yl]methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 118542945) has the molecular formula C21H28N6O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is 3-[5-methyl-3-[[1-(1,2-oxazol-4-ylsulfonyl)piperidin-4-yl]methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[5-methyl-3-[[1-(1,2-oxazol-4-ylsulfonyl)piperidin-4-yl]methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118542945 |
| Molecular Formula | C21H28N6O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 3-[5-methyl-3-[[1-(1,2-oxazol-4-ylsulfonyl)piperidin-4-yl]methyl]-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(C)CN(CC3CCN(S(=O)(=O)c4cnoc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C21H28N6O4S/c1-15-11-25(21(28)27(12-15)18-4-2-3-17(9-18)20(22)23)13-16-5-7-26(8-6-16)32(29,30)19-10-24-31-14-19/h2-4,9-10,14-16H,5-8,11-13H2,1H3,(H3,22,23) |
| InChIKey | AVOZMLHOTRKXHT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|