C25H33N5O4S — CID 118542830
3-[3-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-(methoxymethyl)-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 118542830) has the molecular formula C25H33N5O4S and a molecular weight of 499.64 g/mol. Its IUPAC name is 3-[3-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-(methoxymethyl)-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[3-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-(methoxymethyl)-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118542830 |
| Molecular Formula | C25H33N5O4S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 3-[3-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-(methoxymethyl)-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(COC)CN(CC3CCN(S(=O)(=O)c4ccccc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C25H33N5O4S/c1-34-18-20-16-28(25(31)30(17-20)22-7-5-6-21(14-22)24(26)27)15-19-10-12-29(13-11-19)35(32,33)23-8-3-2-4-9-23/h2-9,14,19-20H,10-13,15-18H2,1H3,(H3,26,27) |
| InChIKey | PMOLWPBFZZCYCO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|