C33H42N6O — CID 118542818
3-[3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-5-[(2-phenylethylamino)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 118542818) has the molecular formula C33H42N6O and a molecular weight of 538.74 g/mol. Its IUPAC name is 3-[3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-5-[(2-phenylethylamino)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-5-[(2-phenylethylamino)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118542818 |
| Molecular Formula | C33H42N6O |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | 3-[3-[(1-benzylpiperidin-4-yl)methyl]-2-oxo-5-[(2-phenylethylamino)methyl]-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(CNCCc3ccccc3)CN(CC3CCN(Cc4ccccc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C33H42N6O/c34-32(35)30-12-7-13-31(20-30)39-25-29(21-36-17-14-26-8-3-1-4-9-26)24-38(33(39)40)23-28-15-18-37(19-16-28)22-27-10-5-2-6-11-27/h1-13,20,28-29,36H,14-19,21-25H2,(H3,34,35) |
| InChIKey | RNHZTQXQCNFIBS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|