C17H32I2 — CID 118569157
(3S,4R,7S)-2-iodo-4-(iodomethyl)-3,7-dimethyl-11-methylidenetridecane (PubChem CID 118569157) has the molecular formula C17H32I2 and a molecular weight of 490.25 g/mol. Its IUPAC name is (3S,4R,7S)-2-iodo-4-(iodomethyl)-3,7-dimethyl-11-methylidenetridecane.
| Compound Name | (3S,4R,7S)-2-iodo-4-(iodomethyl)-3,7-dimethyl-11-methylidenetridecane |
|---|---|
| PubChem CID | 118569157 |
| Molecular Formula | C17H32I2 |
| Molecular Weight | 490.25 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | (3S,4R,7S)-2-iodo-4-(iodomethyl)-3,7-dimethyl-11-methylidenetridecane |
| SMILES | C=C(CC)CCC[C@H](C)CC[C@@H](CI)[C@H](C)C(C)I |
| InChI | InChI=1S/C17H32I2/c1-6-13(2)8-7-9-14(3)10-11-17(12-18)15(4)16(5)19/h14-17H,2,6-12H2,1,3-5H3/t14-,15+,16?,17-/m0/s1 |
| InChIKey | AWLKKIDVFVFSIC-WFVVYAPDSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.25 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|