C9H15NOS2 — CID 11858486
(4S)-3-[(Z)-1-hydroxyprop-1-enyl]-4-propan-2-yl-1,3-thiazolidine-2-thione (PubChem CID 11858486) has the molecular formula C9H15NOS2 and a molecular weight of 217.36 g/mol. Its IUPAC name is (4S)-3-[(Z)-1-hydroxyprop-1-enyl]-4-propan-2-yl-1,3-thiazolidine-2-thione.
| Compound Name | (4S)-3-[(Z)-1-hydroxyprop-1-enyl]-4-propan-2-yl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 11858486 |
| Molecular Formula | C9H15NOS2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | (4S)-3-[(Z)-1-hydroxyprop-1-enyl]-4-propan-2-yl-1,3-thiazolidine-2-thione |
| SMILES | C/C=C(\O)N1C(=S)SC[C@@H]1C(C)C |
| InChI | InChI=1S/C9H15NOS2/c1-4-8(11)10-7(6(2)3)5-13-9(10)12/h4,6-7,11H,5H2,1-3H3/b8-4-/t7-/m1/s1 |
| InChIKey | WCOUKHOSFPNWTE-UDGZVJEDSA-N |
| XLogP | 2.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|