C13H20ClNO2S2 — CID 118542640
(E,3S)-7-chloro-3-hydroxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]hept-4-en-2-one (PubChem CID 118542640) has the molecular formula C13H20ClNO2S2 and a molecular weight of 321.90 g/mol. Its IUPAC name is (E,3S)-7-chloro-3-hydroxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]hept-4-en-2-one.
| Compound Name | (E,3S)-7-chloro-3-hydroxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]hept-4-en-2-one |
|---|---|
| PubChem CID | 118542640 |
| Molecular Formula | C13H20ClNO2S2 |
| Molecular Weight | 321.90 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (E,3S)-7-chloro-3-hydroxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]hept-4-en-2-one |
| SMILES | CC(C)[C@@H]1CSC(=S)N1CC(=O)[C@@H](O)/C=C/CCCl |
| InChI | InChI=1S/C13H20ClNO2S2/c1-9(2)10-8-19-13(18)15(10)7-12(17)11(16)5-3-4-6-14/h3,5,9-11,16H,4,6-8H2,1-2H3/b5-3+/t10-,11-/m0/s1 |
| InChIKey | HLVNLHHDAPBGJB-UTSBZEJYSA-N |
| XLogP | 2.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.90 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|