C13H16Br2N2O5 — CID 118586496
tert-butyl N-[2-(3,5-dibromo-2-hydroxyanilino)-2-oxoethoxy]carbamate (PubChem CID 118586496) has the molecular formula C13H16Br2N2O5 and a molecular weight of 440.09 g/mol. Its IUPAC name is tert-butyl N-[2-(3,5-dibromo-2-hydroxyanilino)-2-oxoethoxy]carbamate.
| Compound Name | tert-butyl N-[2-(3,5-dibromo-2-hydroxyanilino)-2-oxoethoxy]carbamate |
|---|---|
| PubChem CID | 118586496 |
| Molecular Formula | C13H16Br2N2O5 |
| Molecular Weight | 440.09 g/mol |
| Exact Mass | 437.94 |
| IUPAC Name | tert-butyl N-[2-(3,5-dibromo-2-hydroxyanilino)-2-oxoethoxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NOCC(=O)Nc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C13H16Br2N2O5/c1-13(2,3)22-12(20)17-21-6-10(18)16-9-5-7(14)4-8(15)11(9)19/h4-5,19H,6H2,1-3H3,(H,16,18)(H,17,20) |
| InChIKey | XWFIFXUDRZAOSE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.09 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|