C32H37F5N2 — CID 118593557
5-[4-(3,5-difluoro-4-pentylphenyl)-2,3,6-trifluorophenyl]-2-(4-pentylcyclohexyl)pyrimidine (PubChem CID 118593557) has the molecular formula C32H37F5N2 and a molecular weight of 544.65 g/mol. Its IUPAC name is 5-[4-(3,5-difluoro-4-pentylphenyl)-2,3,6-trifluorophenyl]-2-(4-pentylcyclohexyl)pyrimidine.
| Compound Name | 5-[4-(3,5-difluoro-4-pentylphenyl)-2,3,6-trifluorophenyl]-2-(4-pentylcyclohexyl)pyrimidine |
|---|---|
| PubChem CID | 118593557 |
| Molecular Formula | C32H37F5N2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 5-[4-(3,5-difluoro-4-pentylphenyl)-2,3,6-trifluorophenyl]-2-(4-pentylcyclohexyl)pyrimidine |
| SMILES | CCCCCc1c(F)cc(-c2cc(F)c(-c3cnc(C4CCC(CCCCC)CC4)nc3)c(F)c2F)cc1F |
| InChI | InChI=1S/C32H37F5N2/c1-3-5-7-9-20-11-13-21(14-12-20)32-38-18-23(19-39-32)29-28(35)17-25(30(36)31(29)37)22-15-26(33)24(27(34)16-22)10-8-6-4-2/h15-21H,3-14H2,1-2H3 |
| InChIKey | AOFPVMWRBRFYEB-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|