C11H18N2 — CID 118595867
2,3,6-trimethyl-1,2,3,4,4a,5-hexahydroquinoxaline (PubChem CID 118595867) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2,3,6-trimethyl-1,2,3,4,4a,5-hexahydroquinoxaline.
| Compound Name | 2,3,6-trimethyl-1,2,3,4,4a,5-hexahydroquinoxaline |
|---|---|
| PubChem CID | 118595867 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2,3,6-trimethyl-1,2,3,4,4a,5-hexahydroquinoxaline |
| SMILES | CC1=CC=C2NC(C)C(C)NC2C1 |
| InChI | InChI=1S/C11H18N2/c1-7-4-5-10-11(6-7)13-9(3)8(2)12-10/h4-5,8-9,11-13H,6H2,1-3H3 |
| InChIKey | KDIQQKYNFDRMNQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |