C20H25F3N2O4 — CID 118613918
tert-butyl N-[(2R,3S)-5-morpholin-4-yl-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-pyran-3-yl]carbamate (PubChem CID 118613918) has the molecular formula C20H25F3N2O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-5-morpholin-4-yl-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-pyran-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-5-morpholin-4-yl-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-pyran-3-yl]carbamate |
|---|---|
| PubChem CID | 118613918 |
| Molecular Formula | C20H25F3N2O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | tert-butyl N-[(2R,3S)-5-morpholin-4-yl-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-pyran-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(N2CCOCC2)=CO[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H25F3N2O4/c1-20(2,3)29-19(26)24-17-8-12(25-4-6-27-7-5-25)11-28-18(17)13-9-15(22)16(23)10-14(13)21/h9-11,17-18H,4-8H2,1-3H3,(H,24,26)/t17-,18+/m0/s1 |
| InChIKey | YQVLNPQMVHLIGZ-ZWKOTPCHSA-N |
| XLogP | 3.63 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|