C25H28ClN7O2 — CID 118643726
(1S,2S,3R,4R)-3-[[5-chloro-2-[4-[dimethylamino(ethyl)carbamoyl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 118643726) has the molecular formula C25H28ClN7O2 and a molecular weight of 494.00 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[5-chloro-2-[4-[dimethylamino(ethyl)carbamoyl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[4-[dimethylamino(ethyl)carbamoyl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 118643726 |
| Molecular Formula | C25H28ClN7O2 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[4-[dimethylamino(ethyl)carbamoyl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCN(C(=O)c1ccc(-c2nc3nc(Cl)cc(N[C@H]4[C@@H](C(N)=O)[C@@H]5C=C[C@H]4C5)c3[nH]2)cc1)N(C)C |
| InChI | InChI=1S/C25H28ClN7O2/c1-4-33(32(2)3)25(35)14-7-5-13(6-8-14)23-30-21-17(12-18(26)29-24(21)31-23)28-20-16-10-9-15(11-16)19(20)22(27)34/h5-10,12,15-16,19-20H,4,11H2,1-3H3,(H2,27,34)(H2,28,29,30,31)/t15-,16+,19+,20-/m1/s1 |
| InChIKey | IMIIBBIIKPATFT-GIYDNNGJSA-N |
| XLogP | 3.30 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|