C23H30O4 — CID 118647935
7-[5-oxo-2-[(E)-2-phenylethenyl]-3-prop-2-enoxycyclopentyl]heptanoic acid (PubChem CID 118647935) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 7-[5-oxo-2-[(E)-2-phenylethenyl]-3-prop-2-enoxycyclopentyl]heptanoic acid.
| Compound Name | 7-[5-oxo-2-[(E)-2-phenylethenyl]-3-prop-2-enoxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 118647935 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 7-[5-oxo-2-[(E)-2-phenylethenyl]-3-prop-2-enoxycyclopentyl]heptanoic acid |
| SMILES | C=CCOC1CC(=O)C(CCCCCCC(=O)O)C1/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H30O4/c1-2-16-27-22-17-21(24)19(12-8-3-4-9-13-23(25)26)20(22)15-14-18-10-6-5-7-11-18/h2,5-7,10-11,14-15,19-20,22H,1,3-4,8-9,12-13,16-17H2,(H,25,26)/b15-14+ |
| InChIKey | KATIMJCLIDEIMK-CCEZHUSRSA-N |
| XLogP | 4.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|