C29H32N2O5S — CID 118657052
[3-[2-[4-(diethylamino)phenyl]quinolin-8-yl]oxy-2-hydroxypropyl] 4-methylbenzenesulfonate (PubChem CID 118657052) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is [3-[2-[4-(diethylamino)phenyl]quinolin-8-yl]oxy-2-hydroxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [3-[2-[4-(diethylamino)phenyl]quinolin-8-yl]oxy-2-hydroxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118657052 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [3-[2-[4-(diethylamino)phenyl]quinolin-8-yl]oxy-2-hydroxypropyl] 4-methylbenzenesulfonate |
| SMILES | CCN(CC)c1ccc(-c2ccc3cccc(OCC(O)COS(=O)(=O)c4ccc(C)cc4)c3n2)cc1 |
| InChI | InChI=1S/C29H32N2O5S/c1-4-31(5-2)24-14-11-22(12-15-24)27-18-13-23-7-6-8-28(29(23)30-27)35-19-25(32)20-36-37(33,34)26-16-9-21(3)10-17-26/h6-18,25,32H,4-5,19-20H2,1-3H3 |
| InChIKey | XZCYLBGSGATVIM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|