C30H58N2O2S2 — CID 118660530
O-nonyl 2-amino-2-[1,3,3-trimethyl-5-(nonylsulfanylcarbonylamino)cyclohexyl]ethanethioate (PubChem CID 118660530) has the molecular formula C30H58N2O2S2 and a molecular weight of 542.94 g/mol. Its IUPAC name is O-nonyl 2-amino-2-[1,3,3-trimethyl-5-(nonylsulfanylcarbonylamino)cyclohexyl]ethanethioate.
| Compound Name | O-nonyl 2-amino-2-[1,3,3-trimethyl-5-(nonylsulfanylcarbonylamino)cyclohexyl]ethanethioate |
|---|---|
| PubChem CID | 118660530 |
| Molecular Formula | C30H58N2O2S2 |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 542.39 |
| IUPAC Name | O-nonyl 2-amino-2-[1,3,3-trimethyl-5-(nonylsulfanylcarbonylamino)cyclohexyl]ethanethioate |
| SMILES | CCCCCCCCCOC(=S)C(N)C1(C)CC(NC(=O)SCCCCCCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C30H58N2O2S2/c1-6-8-10-12-14-16-18-20-34-27(35)26(31)30(5)23-25(22-29(3,4)24-30)32-28(33)36-21-19-17-15-13-11-9-7-2/h25-26H,6-24,31H2,1-5H3,(H,32,33) |
| InChIKey | CZBNEMMPJRUSIE-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|