C20H38N2O2S2 — CID 118660472
O-butyl 2-amino-2-[5-(butylsulfanylcarbonylamino)-1,3,3-trimethylcyclohexyl]ethanethioate (PubChem CID 118660472) has the molecular formula C20H38N2O2S2 and a molecular weight of 402.67 g/mol. Its IUPAC name is O-butyl 2-amino-2-[5-(butylsulfanylcarbonylamino)-1,3,3-trimethylcyclohexyl]ethanethioate.
| Compound Name | O-butyl 2-amino-2-[5-(butylsulfanylcarbonylamino)-1,3,3-trimethylcyclohexyl]ethanethioate |
|---|---|
| PubChem CID | 118660472 |
| Molecular Formula | C20H38N2O2S2 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | O-butyl 2-amino-2-[5-(butylsulfanylcarbonylamino)-1,3,3-trimethylcyclohexyl]ethanethioate |
| SMILES | CCCCOC(=S)C(N)C1(C)CC(NC(=O)SCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C20H38N2O2S2/c1-6-8-10-24-17(25)16(21)20(5)13-15(12-19(3,4)14-20)22-18(23)26-11-9-7-2/h15-16H,6-14,21H2,1-5H3,(H,22,23) |
| InChIKey | SDEDASXIURLDBU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|