C20H38N2O4 — CID 88612643
butyl N-[3-[butoxy(formamido)methyl]-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 88612643) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is butyl N-[3-[butoxy(formamido)methyl]-3,5,5-trimethylcyclohexyl]carbamate.
| Compound Name | butyl N-[3-[butoxy(formamido)methyl]-3,5,5-trimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 88612643 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | butyl N-[3-[butoxy(formamido)methyl]-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CCCCOC(=O)NC1CC(C)(C)CC(C)(C(NC=O)OCCCC)C1 |
| InChI | InChI=1S/C20H38N2O4/c1-6-8-10-25-17(21-15-23)20(5)13-16(12-19(3,4)14-20)22-18(24)26-11-9-7-2/h15-17H,6-14H2,1-5H3,(H,21,23)(H,22,24) |
| InChIKey | GVIGPMTVYITZSD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|