C12H13ClFN3O3S — CID 118674198
(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-(chloromethyl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 118674198) has the molecular formula C12H13ClFN3O3S and a molecular weight of 333.77 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-(chloromethyl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-(chloromethyl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 118674198 |
| Molecular Formula | C12H13ClFN3O3S |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | (2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-(chloromethyl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c([C@@H]3O[C@@](CO)(CCl)[C@@H](O)[C@H]3F)csc12 |
| InChI | InChI=1S/C12H13ClFN3O3S/c13-2-12(3-18)10(19)6(14)8(20-12)5-1-21-9-7(5)16-4-17-11(9)15/h1,4,6,8,10,18-19H,2-3H2,(H2,15,16,17)/t6-,8-,10-,12+/m0/s1 |
| InChIKey | OFSPMNLLQXJCKJ-ROFGYOSQSA-N |
| XLogP | 1.01 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|