C11H15FN6O4 — CID 123324381
5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2,2-bis(hydroxymethyl)oxolan-3-ol (PubChem CID 123324381) has the molecular formula C11H15FN6O4 and a molecular weight of 314.28 g/mol. Its IUPAC name is 5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2,2-bis(hydroxymethyl)oxolan-3-ol.
| Compound Name | 5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2,2-bis(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 123324381 |
| Molecular Formula | C11H15FN6O4 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2,2-bis(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1nc(N)c2ncc(C3OC(CO)(CO)C(O)C3F)n2n1 |
| InChI | InChI=1S/C11H15FN6O4/c12-5-6(22-11(2-19,3-20)7(5)21)4-1-15-9-8(13)16-10(14)17-18(4)9/h1,5-7,19-21H,2-3H2,(H4,13,14,16,17) |
| InChIKey | ZFWKRVVZRJEHNP-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 165.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|