C11H11N9O3S — CID 118674183
(2R,3S,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2,4-diazido-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 118674183) has the molecular formula C11H11N9O3S and a molecular weight of 349.34 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2,4-diazido-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2,4-diazido-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 118674183 |
| Molecular Formula | C11H11N9O3S |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (2R,3S,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2,4-diazido-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=N[C@H]1[C@H](c2csc3c(N)ncnc23)O[C@@](CO)(N=[N+]=[N-])[C@H]1O |
| InChI | InChI=1S/C11H11N9O3S/c12-10-8-5(15-3-16-10)4(1-24-8)7-6(17-19-13)9(22)11(2-21,23-7)18-20-14/h1,3,6-7,9,21-22H,2H2,(H2,12,15,16)/t6-,7-,9-,11+/m0/s1 |
| InChIKey | SWRUHGQEFHFYCS-BGTQOLROSA-N |
| XLogP | 1.38 |
| TPSA | 199.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|