C11H13N11O2 — CID 101335301
[(2R,3S,4S,5R)-5-[(6-aminopurin-9-yl)methyl]-3,4-diazidooxolan-2-yl]methanol (PubChem CID 101335301) has the molecular formula C11H13N11O2 and a molecular weight of 331.30 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-[(6-aminopurin-9-yl)methyl]-3,4-diazidooxolan-2-yl]methanol.
| Compound Name | [(2R,3S,4S,5R)-5-[(6-aminopurin-9-yl)methyl]-3,4-diazidooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 101335301 |
| Molecular Formula | C11H13N11O2 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [(2R,3S,4S,5R)-5-[(6-aminopurin-9-yl)methyl]-3,4-diazidooxolan-2-yl]methanol |
| SMILES | [N-]=[N+]=N[C@H]1[C@H](N=[N+]=[N-])[C@@H](Cn2cnc3c(N)ncnc32)O[C@H]1CO |
| InChI | InChI=1S/C11H13N11O2/c12-10-9-11(16-3-15-10)22(4-17-9)1-5-7(18-20-13)8(19-21-14)6(2-23)24-5/h3-8,23H,1-2H2,(H2,12,15,16)/t5-,6+,7-,8-/m1/s1 |
| InChIKey | BOMNSHXMUJUAIR-ULAWRXDQSA-N |
| XLogP | 0.53 |
| TPSA | 196.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|