C15H26O3S6 — CID 118674593
O-[2,2-bis(3-sulfanylpropanethioyloxymethyl)butyl] 3-sulfanylpropanethioate (PubChem CID 118674593) has the molecular formula C15H26O3S6 and a molecular weight of 446.77 g/mol. Its IUPAC name is O-[2,2-bis(3-sulfanylpropanethioyloxymethyl)butyl] 3-sulfanylpropanethioate.
| Compound Name | O-[2,2-bis(3-sulfanylpropanethioyloxymethyl)butyl] 3-sulfanylpropanethioate |
|---|---|
| PubChem CID | 118674593 |
| Molecular Formula | C15H26O3S6 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | O-[2,2-bis(3-sulfanylpropanethioyloxymethyl)butyl] 3-sulfanylpropanethioate |
| SMILES | CCC(COC(=S)CCS)(COC(=S)CCS)COC(=S)CCS |
| InChI | InChI=1S/C15H26O3S6/c1-2-15(9-16-12(22)3-6-19,10-17-13(23)4-7-20)11-18-14(24)5-8-21/h19-21H,2-11H2,1H3 |
| InChIKey | MUKRBTQCCMGYNH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|