C20H31N3O5 — CID 118711357
1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]oxy-3-(morpholin-4-ylamino)propan-2-ol (PubChem CID 118711357) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is 1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]oxy-3-(morpholin-4-ylamino)propan-2-ol.
| Compound Name | 1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]oxy-3-(morpholin-4-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 118711357 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]oxy-3-(morpholin-4-ylamino)propan-2-ol |
| SMILES | COc1ccc(/C=N/OCC(O)CNN2CCOCC2)cc1OC1CCCC1 |
| InChI | InChI=1S/C20H31N3O5/c1-25-19-7-6-16(12-20(19)28-18-4-2-3-5-18)13-22-27-15-17(24)14-21-23-8-10-26-11-9-23/h6-7,12-13,17-18,21,24H,2-5,8-11,14-15H2,1H3/b22-13+ |
| InChIKey | XRDGDVJELSEKQQ-LPYMAVHISA-N |
| XLogP | 1.56 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|