C20H30N2O5 — CID 44541895
(2S)-1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]oxy-3-morpholin-4-ylpropan-2-ol (PubChem CID 44541895) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is (2S)-1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]oxy-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]oxy-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 44541895 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (2S)-1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]oxy-3-morpholin-4-ylpropan-2-ol |
| SMILES | COc1ccc(/C=N/OC[C@@H](O)CN2CCOCC2)cc1OC1CCCC1 |
| InChI | InChI=1S/C20H30N2O5/c1-24-19-7-6-16(12-20(19)27-18-4-2-3-5-18)13-21-26-15-17(23)14-22-8-10-25-11-9-22/h6-7,12-13,17-18,23H,2-5,8-11,14-15H2,1H3/b21-13+/t17-/m0/s1 |
| InChIKey | QQPQPLHZCIULFX-RSZPVBOMSA-N |
| XLogP | 2.06 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|