C20H18Cl2N4OS — CID 118713746
3-(2,4-dichlorophenyl)-11-methyl-N-pyrrolidin-1-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene-5-carboxamide (PubChem CID 118713746) has the molecular formula C20H18Cl2N4OS and a molecular weight of 433.36 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-11-methyl-N-pyrrolidin-1-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene-5-carboxamide.
| Compound Name | 3-(2,4-dichlorophenyl)-11-methyl-N-pyrrolidin-1-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 118713746 |
| Molecular Formula | C20H18Cl2N4OS |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-11-methyl-N-pyrrolidin-1-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene-5-carboxamide |
| SMILES | Cc1csc2c1-c1c(c(C(=O)NN3CCCC3)nn1-c1ccc(Cl)cc1Cl)C2 |
| InChI | InChI=1S/C20H18Cl2N4OS/c1-11-10-28-16-9-13-18(20(27)24-25-6-2-3-7-25)23-26(19(13)17(11)16)15-5-4-12(21)8-14(15)22/h4-5,8,10H,2-3,6-7,9H2,1H3,(H,24,27) |
| InChIKey | JRSWOHBUHKRXPQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |